C13H12FN3O5S — CID 136743719
2-[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid (PubChem CID 136743719) has the molecular formula C13H12FN3O5S and a molecular weight of 341.32 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 136743719 |
| Molecular Formula | C13H12FN3O5S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)sulfonylamino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(F)cc2)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C13H12FN3O5S/c1-7-10(6-11(18)19)12(20)16-13(15-7)17-23(21,22)9-4-2-8(14)3-5-9/h2-5H,6H2,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | RUTXFUAWXOETJD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |