C13H12N2S2 — CID 136745893
4-[(4-methylphenyl)diazenyl]benzene-1,2-dithiol (PubChem CID 136745893) has the molecular formula C13H12N2S2 and a molecular weight of 260.39 g/mol. Its IUPAC name is 4-[(4-methylphenyl)diazenyl]benzene-1,2-dithiol.
| Compound Name | 4-[(4-methylphenyl)diazenyl]benzene-1,2-dithiol |
|---|---|
| PubChem CID | 136745893 |
| Molecular Formula | C13H12N2S2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-[(4-methylphenyl)diazenyl]benzene-1,2-dithiol |
| SMILES | Cc1ccc(/N=N/c2ccc(S)c(S)c2)cc1 |
| InChI | InChI=1S/C13H12N2S2/c1-9-2-4-10(5-3-9)14-15-11-6-7-12(16)13(17)8-11/h2-8,16-17H,1H3/b15-14+ |
| InChIKey | HWTIDZZCRWLTCL-CCEZHUSRSA-N |
| XLogP | 4.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|