C13H14S2 — CID 174679566
benzene;4-methylbenzene-1,2-dithiol (PubChem CID 174679566) has the molecular formula C13H14S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is benzene;4-methylbenzene-1,2-dithiol.
| Compound Name | benzene;4-methylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 174679566 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | benzene;4-methylbenzene-1,2-dithiol |
| SMILES | Cc1ccc(S)c(S)c1.c1ccccc1 |
| InChI | InChI=1S/C7H8S2.C6H6/c1-5-2-3-6(8)7(9)4-5;1-2-4-6-5-3-1/h2-4,8-9H,1H3;1-6H |
| InChIKey | IXUJSRXENRYCFZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|