C31H27ClF3N5O6 — CID 136748079
(5R,7R)-3-chloro-N-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136748079) has the molecular formula C31H27ClF3N5O6 and a molecular weight of 658.03 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136748079 |
| Molecular Formula | C31H27ClF3N5O6 |
| Molecular Weight | 658.03 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | (5R,7R)-3-chloro-N-[3-(2,3-dihydro-1H-inden-5-yloxy)-5-nitrophenyl]-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@H](C(F)(F)F)n3nc(C(=O)Nc4cc(Oc5ccc6c(c5)CCC6)cc([N+](=O)[O-])c4)c(Cl)c3N2)cc1OC |
| InChI | InChI=1S/C31H27ClF3N5O6/c1-44-24-9-7-18(11-25(24)45-2)23-15-26(31(33,34)35)39-29(37-23)27(32)28(38-39)30(41)36-19-12-20(40(42)43)14-22(13-19)46-21-8-6-16-4-3-5-17(16)10-21/h6-14,23,26,37H,3-5,15H2,1-2H3,(H,36,41)/t23-,26-/m1/s1 |
| InChIKey | WFXYOFDUQQANJC-ZEQKJWHPSA-N |
| XLogP | 7.66 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.03 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|