C19H18ClN3O5S — CID 136755689
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate (PubChem CID 136755689) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 136755689 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](OC(=O)CCNS(=O)(=O)c1cccc(Cl)c1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18ClN3O5S/c1-12(18-22-16-8-3-2-7-15(16)19(25)23-18)28-17(24)9-10-21-29(26,27)14-6-4-5-13(20)11-14/h2-8,11-12,21H,9-10H2,1H3,(H,22,23,25)/t12-/m0/s1 |
| InChIKey | YVEFVFFQIDZSDK-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |