C16H18N4O — CID 136756556
2-ethylimino-5-(indol-3-ylidenemethyl)-1,3-dimethylimidazol-4-ol (PubChem CID 136756556) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-ethylimino-5-(indol-3-ylidenemethyl)-1,3-dimethylimidazol-4-ol.
| Compound Name | 2-ethylimino-5-(indol-3-ylidenemethyl)-1,3-dimethylimidazol-4-ol |
|---|---|
| PubChem CID | 136756556 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-ethylimino-5-(indol-3-ylidenemethyl)-1,3-dimethylimidazol-4-ol |
| SMILES | CC/N=c1\n(C)c(O)c(C=C2C=Nc3ccccc32)n1C |
| InChI | InChI=1S/C16H18N4O/c1-4-17-16-19(2)14(15(21)20(16)3)9-11-10-18-13-8-6-5-7-12(11)13/h5-10,21H,4H2,1-3H3/b11-9?,17-16- |
| InChIKey | UIFLDXAMSCVLFF-UMOOMMFGSA-N |
| XLogP | 2.25 |
| TPSA | 54.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |