C25H26N2O2 — CID 136756877
3-(N-benzyl-C-ethylcarbonimidoyl)-4-hydroxy-1-phenyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 136756877) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-(N-benzyl-C-ethylcarbonimidoyl)-4-hydroxy-1-phenyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 3-(N-benzyl-C-ethylcarbonimidoyl)-4-hydroxy-1-phenyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 136756877 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-(N-benzyl-C-ethylcarbonimidoyl)-4-hydroxy-1-phenyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CC/C(=N\Cc1ccccc1)c1c(O)c2c(n(-c3ccccc3)c1=O)CCCC2 |
| InChI | InChI=1S/C25H26N2O2/c1-2-21(26-17-18-11-5-3-6-12-18)23-24(28)20-15-9-10-16-22(20)27(25(23)29)19-13-7-4-8-14-19/h3-8,11-14,28H,2,9-10,15-17H2,1H3/b26-21+ |
| InChIKey | FUTCRMBYWCCYMH-YYADALCUSA-N |
| XLogP | 4.82 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|