C18H19NO3 — CID 2785579
3-hydroxy-6-phenyl-3,4,7,8,9,10-hexahydro-2H-pyrano[3,2-c]quinolin-5-one (PubChem CID 2785579) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-hydroxy-6-phenyl-3,4,7,8,9,10-hexahydro-2H-pyrano[3,2-c]quinolin-5-one.
| Compound Name | 3-hydroxy-6-phenyl-3,4,7,8,9,10-hexahydro-2H-pyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 2785579 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-hydroxy-6-phenyl-3,4,7,8,9,10-hexahydro-2H-pyrano[3,2-c]quinolin-5-one |
| SMILES | O=c1c2c(c3c(n1-c1ccccc1)CCCC3)OCC(O)C2 |
| InChI | InChI=1S/C18H19NO3/c20-13-10-15-17(22-11-13)14-8-4-5-9-16(14)19(18(15)21)12-6-2-1-3-7-12/h1-3,6-7,13,20H,4-5,8-11H2 |
| InChIKey | HCBJENMURQCZLG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |