C24H27N — CID 10711446
2-tert-butyl-1,3-diphenyl-4,5,6,7-tetrahydroindole (PubChem CID 10711446) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-tert-butyl-1,3-diphenyl-4,5,6,7-tetrahydroindole.
| Compound Name | 2-tert-butyl-1,3-diphenyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 10711446 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-tert-butyl-1,3-diphenyl-4,5,6,7-tetrahydroindole |
| SMILES | CC(C)(C)c1c(-c2ccccc2)c2c(n1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C24H27N/c1-24(2,3)23-22(18-12-6-4-7-13-18)20-16-10-11-17-21(20)25(23)19-14-8-5-9-15-19/h4-9,12-15H,10-11,16-17H2,1-3H3 |
| InChIKey | PELPLROIBHTSMF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |