C22H18ClNO3 — CID 11794133
(2-oxo-1-phenyl-5,6,7,8-tetrahydroquinolin-4-yl) 2-chlorobenzoate (PubChem CID 11794133) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is (2-oxo-1-phenyl-5,6,7,8-tetrahydroquinolin-4-yl) 2-chlorobenzoate.
| Compound Name | (2-oxo-1-phenyl-5,6,7,8-tetrahydroquinolin-4-yl) 2-chlorobenzoate |
|---|---|
| PubChem CID | 11794133 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2-oxo-1-phenyl-5,6,7,8-tetrahydroquinolin-4-yl) 2-chlorobenzoate |
| SMILES | O=C(Oc1cc(=O)n(-c2ccccc2)c2c1CCCC2)c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO3/c23-18-12-6-4-10-16(18)22(26)27-20-14-21(25)24(15-8-2-1-3-9-15)19-13-7-5-11-17(19)20/h1-4,6,8-10,12,14H,5,7,11,13H2 |
| InChIKey | CAUGEVFWZOQHDM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |