C21H26F3N5O2 — CID 136760499
3-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 136760499) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 3-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 136760499 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[2-[(5R,7R)-5-ethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | CC[C@@H]1C[C@H](C(F)(F)F)n2nc(C3CCCN3C(=O)c3c(C)cc(C)[nH]c3=O)cc2N1 |
| InChI | InChI=1S/C21H26F3N5O2/c1-4-13-9-16(21(22,23)24)29-17(26-13)10-14(27-29)15-6-5-7-28(15)20(31)18-11(2)8-12(3)25-19(18)30/h8,10,13,15-16,26H,4-7,9H2,1-3H3,(H,25,30)/t13-,15?,16-/m1/s1 |
| InChIKey | RWUPGZRYMSJLLC-YAELJHOLSA-N |
| XLogP | 3.86 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |