C21H33F3N4O — CID 135963547
1-[(3S)-3-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-ethylbutan-1-one (PubChem CID 135963547) has the molecular formula C21H33F3N4O and a molecular weight of 414.52 g/mol. Its IUPAC name is 1-[(3S)-3-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[(3S)-3-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 135963547 |
| Molecular Formula | C21H33F3N4O |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 1-[(3S)-3-[(5S,7R)-5-tert-butyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]pyrrolidin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CC[C@H](c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](C(C)(C)C)N3)C1 |
| InChI | InChI=1S/C21H33F3N4O/c1-6-13(7-2)19(29)27-9-8-14(12-27)15-10-18-25-16(20(3,4)5)11-17(21(22,23)24)28(18)26-15/h10,13-14,16-17,25H,6-9,11-12H2,1-5H3/t14-,16-,17+/m0/s1 |
| InChIKey | AHEPKKKOCQKSNM-BHYGNILZSA-N |
| XLogP | 4.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |