C23H37F2N5O — CID 136760722
1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-piperidin-1-ylethanone (PubChem CID 136760722) has the molecular formula C23H37F2N5O and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-piperidin-1-ylethanone.
| Compound Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 136760722 |
| Molecular Formula | C23H37F2N5O |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 1-[4-[(5S,7R)-2-tert-butyl-7-(difluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-piperidin-1-ylethanone |
| SMILES | CC(C)(C)c1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCN(C(=O)CN3CCCCC3)CC1)N2 |
| InChI | InChI=1S/C23H37F2N5O/c1-23(2,3)19-14-20-26-17(13-18(22(24)25)30(20)27-19)16-7-11-29(12-8-16)21(31)15-28-9-5-4-6-10-28/h14,16-18,22,26H,4-13,15H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | ORNHHTGIFUXZPC-ZWKOTPCHSA-N |
| XLogP | 3.90 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |