C20H29F3N4O — CID 136760778
2-cyclopentyl-1-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone (PubChem CID 136760778) has the molecular formula C20H29F3N4O and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-cyclopentyl-1-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 136760778 |
| Molecular Formula | C20H29F3N4O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-cyclopentyl-1-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]ethanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](C1CCCN(C(=O)CC3CCCC3)C1)N2 |
| InChI | InChI=1S/C20H29F3N4O/c1-13-9-18-24-16(11-17(20(21,22)23)27(18)25-13)15-7-4-8-26(12-15)19(28)10-14-5-2-3-6-14/h9,14-17,24H,2-8,10-12H2,1H3/t15?,16-,17+/m0/s1 |
| InChIKey | RAOCIKLHRIJEAM-LRUHZDSUSA-N |
| XLogP | 4.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |