C18H25F3N4O3S — CID 136760798
(1,1-dioxothiolan-3-yl)-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136760798) has the molecular formula C18H25F3N4O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136760798 |
| Molecular Formula | C18H25F3N4O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-[3-[(5S,7R)-2-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](C1CCCN(C(=O)C3CCS(=O)(=O)C3)C1)N2 |
| InChI | InChI=1S/C18H25F3N4O3S/c1-11-7-16-22-14(8-15(18(19,20)21)25(16)23-11)12-3-2-5-24(9-12)17(26)13-4-6-29(27,28)10-13/h7,12-15,22H,2-6,8-10H2,1H3/t12?,13?,14-,15+/m0/s1 |
| InChIKey | CJBZOOYMCMBOMK-PFSRBDOWSA-N |
| XLogP | 2.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |