C21H27N3O2 — CID 136763891
(1S,10R)-5-methyl-13-[(4-propan-2-yloxyphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136763891) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (1S,10R)-5-methyl-13-[(4-propan-2-yloxyphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | (1S,10R)-5-methyl-13-[(4-propan-2-yloxyphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136763891 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (1S,10R)-5-methyl-13-[(4-propan-2-yloxyphenyl)methyl]-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@H]1CC[C@@H](C2)N1Cc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-13(2)26-18-8-4-15(5-9-18)12-24-16-6-7-17(24)11-20-19(10-16)21(25)23-14(3)22-20/h4-5,8-9,13,16-17H,6-7,10-12H2,1-3H3,(H,22,23,25)/t16-,17+/m1/s1 |
| InChIKey | VPEZJHPWEBTPDZ-SJORKVTESA-N |
| XLogP | 3.00 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |