C16H16N4O5 — CID 136766751
(4R,5S)-4-(1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136766751) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is (4R,5S)-4-(1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R,5S)-4-(1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136766751 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (4R,5S)-4-(1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CC(C)n1ncc2c1NC(=O)[C@@H]([N+](=O)[O-])[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N4O5/c1-8(2)19-15-10(6-17-19)13(14(20(22)23)16(21)18-15)9-3-4-11-12(5-9)25-7-24-11/h3-6,8,13-14H,7H2,1-2H3,(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | XHDOLJAXRBBBKL-KGLIPLIRSA-N |
| XLogP | 1.92 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|