C17H18N4O7 — CID 91973016
4-(7-methoxy-1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 91973016) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 91973016 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-nitro-1-propan-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | COc1cc(C2c3c(n(C(C)C)[nH]c3=O)NC(=O)C2[N+](=O)[O-])cc2c1OCO2 |
| InChI | InChI=1S/C17H18N4O7/c1-7(2)20-15-12(16(22)19-20)11(13(21(24)25)17(23)18-15)8-4-9(26-3)14-10(5-8)27-6-28-14/h4-5,7,11,13H,6H2,1-3H3,(H,18,23)(H,19,22) |
| InChIKey | FFXYYGGRXNZSHA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|