C10H15N6O8P — CID 136768322
[(2R,3R,4R,5R)-2-(2,8-diamino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 136768322) has the molecular formula C10H15N6O8P and a molecular weight of 378.24 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2,8-diamino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(2,8-diamino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 136768322 |
| Molecular Formula | C10H15N6O8P |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2,8-diamino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1nc2c(nc(N)n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N6O8P/c11-9-14-6-3(7(19)15-9)13-10(12)16(6)8-5(24-25(20,21)22)4(18)2(1-17)23-8/h2,4-5,8,17-18H,1H2,(H2,12,13)(H2,20,21,22)(H3,11,14,15,19)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | VXACYGZFEOBARD-UMMCILCDSA-N |
| XLogP | -2.99 |
| TPSA | 232.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|