C24H23N5O7S2 — CID 136772625
3-[[[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]amino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 136772625) has the molecular formula C24H23N5O7S2 and a molecular weight of 557.61 g/mol. Its IUPAC name is 3-[[[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]amino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3-[[[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]amino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 136772625 |
| Molecular Formula | C24H23N5O7S2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 3-[[[(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]amino]carbamoyl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NNC(=O)[C@@H](C)/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C24H23N5O7S2/c1-15(25-22-18-10-3-6-13-21(18)38(34,35)29-22)23(30)26-27-24(31)16-8-7-9-17(14-16)37(32,33)28-19-11-4-5-12-20(19)36-2/h3-15,28H,1-2H3,(H,25,29)(H,26,30)(H,27,31)/t15-/m1/s1 |
| InChIKey | DBJCRNZBKQMEGV-OAHLLOKOSA-N |
| XLogP | 1.38 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|