C12H11FN2O — CID 136780625
(NE)-N-(6-fluoro-1,2,3,9-tetrahydrocarbazol-4-ylidene)hydroxylamine (PubChem CID 136780625) has the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. Its IUPAC name is (NE)-N-(6-fluoro-1,2,3,9-tetrahydrocarbazol-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(6-fluoro-1,2,3,9-tetrahydrocarbazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 136780625 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (NE)-N-(6-fluoro-1,2,3,9-tetrahydrocarbazol-4-ylidene)hydroxylamine |
| SMILES | O/N=C1\CCCc2[nH]c3ccc(F)cc3c21 |
| InChI | InChI=1S/C12H11FN2O/c13-7-4-5-9-8(6-7)12-10(14-9)2-1-3-11(12)15-16/h4-6,14,16H,1-3H2/b15-11+ |
| InChIKey | UBDNOZUFIFEYOX-RVDMUPIBSA-N |
| XLogP | 2.82 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|