C27H19FN4O4 — CID 136791214
6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 136791214) has the molecular formula C27H19FN4O4 and a molecular weight of 482.47 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 136791214 |
| Molecular Formula | C27H19FN4O4 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c(/C=N/c2ccc(F)cc2)c(O)c2c(=O)n(-c3ccccc3)c(=O)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C27H19FN4O4/c1-30-24-22(23(33)21(25(30)34)16-29-18-14-12-17(28)13-15-18)26(35)32(20-10-6-3-7-11-20)27(36)31(24)19-8-4-2-5-9-19/h2-16,33H,1H3/b29-16+ |
| InChIKey | UIAZYPYXCXWPLQ-MUFRIFMGSA-N |
| XLogP | 3.44 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|