C10H17N5O — CID 136792793
5-amino-4-[[(1R,2R)-2-aminocyclohexyl]amino]-1H-pyrimidin-6-one (PubChem CID 136792793) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-amino-4-[[(1R,2R)-2-aminocyclohexyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[[(1R,2R)-2-aminocyclohexyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136792793 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5-amino-4-[[(1R,2R)-2-aminocyclohexyl]amino]-1H-pyrimidin-6-one |
| SMILES | Nc1c(N[C@@H]2CCCC[C@H]2N)nc[nH]c1=O |
| InChI | InChI=1S/C10H17N5O/c11-6-3-1-2-4-7(6)15-9-8(12)10(16)14-5-13-9/h5-7H,1-4,11-12H2,(H2,13,14,15,16)/t6-,7-/m1/s1 |
| InChIKey | ZYODBDAUWYFKJV-RNFRBKRXSA-N |
| XLogP | 0.03 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |