C10H19N5O — CID 135449031
2,5-diamino-4-(hexylamino)-1H-pyrimidin-6-one (PubChem CID 135449031) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2,5-diamino-4-(hexylamino)-1H-pyrimidin-6-one.
| Compound Name | 2,5-diamino-4-(hexylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135449031 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2,5-diamino-4-(hexylamino)-1H-pyrimidin-6-one |
| SMILES | CCCCCCNc1nc(N)[nH]c(=O)c1N |
| InChI | InChI=1S/C10H19N5O/c1-2-3-4-5-6-13-8-7(11)9(16)15-10(12)14-8/h2-6,11H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | ILZDSAXMPRCTNU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|