C22H19NOS2 — CID 136797873
N-(3,4-dimethyl-6-thianthren-5-ylidenecyclohexa-2,4-dien-1-ylidene)acetamide (PubChem CID 136797873) has the molecular formula C22H19NOS2 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-(3,4-dimethyl-6-thianthren-5-ylidenecyclohexa-2,4-dien-1-ylidene)acetamide.
| Compound Name | N-(3,4-dimethyl-6-thianthren-5-ylidenecyclohexa-2,4-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 136797873 |
| Molecular Formula | C22H19NOS2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(3,4-dimethyl-6-thianthren-5-ylidenecyclohexa-2,4-dien-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C=C(C)C(C)=CC1=S1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H19NOS2/c1-14-12-17(23-16(3)24)22(13-15(14)2)26-20-10-6-4-8-18(20)25-19-9-5-7-11-21(19)26/h4-13H,1-3H3/b23-17+ |
| InChIKey | FILBZYNNAPIJMG-HAVVHWLPSA-N |
| XLogP | 5.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|