C11H7NOS — CID 136801055
2-(4-ethynyl-1,3-thiazol-2-yl)phenol (PubChem CID 136801055) has the molecular formula C11H7NOS and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(4-ethynyl-1,3-thiazol-2-yl)phenol.
| Compound Name | 2-(4-ethynyl-1,3-thiazol-2-yl)phenol |
|---|---|
| PubChem CID | 136801055 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 2-(4-ethynyl-1,3-thiazol-2-yl)phenol |
| SMILES | C#Cc1csc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C11H7NOS/c1-2-8-7-14-11(12-8)9-5-3-4-6-10(9)13/h1,3-7,13H |
| InChIKey | QMPQGCJFBWUGDV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|