C52H53N8O12S4+3 — CID 136801123
3-[4-[10,15,20-tris[1-(3-sulfopropyl)pyridin-1-ium-4-yl]-21H-porphyrin-5-ylidene]-1-pyridinyl]propane-1-sulfonic acid (PubChem CID 136801123) has the molecular formula C52H53N8O12S4+3 and a molecular weight of 1110.31 g/mol. Its IUPAC name is 3-[4-[10,15,20-tris[1-(3-sulfopropyl)pyridin-1-ium-4-yl]-21H-porphyrin-5-ylidene]-1-pyridinyl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[10,15,20-tris[1-(3-sulfopropyl)pyridin-1-ium-4-yl]-21H-porphyrin-5-ylidene]-1-pyridinyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 136801123 |
| Molecular Formula | C52H53N8O12S4+3 |
| Molecular Weight | 1110.31 g/mol |
| Exact Mass | 1109.26 |
| IUPAC Name | 3-[4-[10,15,20-tris[1-(3-sulfopropyl)pyridin-1-ium-4-yl]-21H-porphyrin-5-ylidene]-1-pyridinyl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN1C=CC(=C2C3=N/C(=C(/c4cc[n+](CCCS(=O)(=O)O)cc4)C4=N/C(=C(/c5cc[n+](CCCS(=O)(=O)O)cc5)C5=N/C(=C(/c6cc[n+](CCCS(=O)(=O)O)cc6)c6ccc2[nH]6)C=C5)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C52H50N8O12S4/c61-73(62,63)33-1-21-57-25-13-37(14-26-57)49-41-5-7-43(53-41)50(38-15-27-58(28-16-38)22-2-34-74(64,65)66)45-9-11-47(55-45)52(40-19-31-60(32-20-40)24-4-36-76(70,71)72)48-12-10-46(56-48)51(44-8-6-42(49)54-44)39-17-29-59(30-18-39)23-3-35-75(67,68)69/h5-20,25-32,53H,1-4,21-24,33-36H2,(H-3,61,62,63,64,65,66,67,68,69,70,71,72)/p+3 |
| InChIKey | ZLUXGYYUJHXTAV-UHFFFAOYSA-Q |
| XLogP | 4.71 |
| TPSA | 285.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|