C44H36FeN8+4 — CID 25200058
iron(2+);5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methyl-4-pyridinylidene)porphyrin-22-ide (PubChem CID 25200058) has the molecular formula C44H36FeN8+4 and a molecular weight of 732.67 g/mol. Its IUPAC name is iron(2+);5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methyl-4-pyridinylidene)porphyrin-22-ide.
| Compound Name | iron(2+);5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methyl-4-pyridinylidene)porphyrin-22-ide |
|---|---|
| PubChem CID | 25200058 |
| Molecular Formula | C44H36FeN8+4 |
| Molecular Weight | 732.67 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | iron(2+);5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methyl-4-pyridinylidene)porphyrin-22-ide |
| SMILES | CN1C=CC(=C2C3=N/C(=C(/c4cc[n+](C)cc4)C4=N/C(=C(/c5cc[n+](C)cc5)c5ccc([n-]5)/C(c5cc[n+](C)cc5)=C5/C=CC2=N5)C=C4)C=C3)C=C1.[Fe+2] |
| InChI | InChI=1S/C44H36N8.Fe/c1-49-21-13-29(14-22-49)41-33-5-7-35(45-33)42(30-15-23-50(2)24-16-30)37-9-11-39(47-37)44(32-19-27-52(4)28-20-32)40-12-10-38(48-40)43(36-8-6-34(41)46-36)31-17-25-51(3)26-18-31;/h5-28H,1-4H3;/q2*+2 |
| InChIKey | UKOUTQOYJGCLRJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|