C68H76N4OZn — CID 11643747
zinc 4-[(1Z,10Z,14Z)-10,15,20-tris(3,5-ditert-butylphenyl)-23H-porphyrin-22,24-diid-5-ylidene]cyclohexa-2,5-dien-1-one (PubChem CID 11643747) has the molecular formula C68H76N4OZn and a molecular weight of 1030.77 g/mol. Its IUPAC name is zinc 4-[(1Z,10Z,14Z)-10,15,20-tris(3,5-ditert-butylphenyl)-23H-porphyrin-22,24-diid-5-ylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | zinc 4-[(1Z,10Z,14Z)-10,15,20-tris(3,5-ditert-butylphenyl)-23H-porphyrin-22,24-diid-5-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 11643747 |
| Molecular Formula | C68H76N4OZn |
| Molecular Weight | 1030.77 g/mol |
| Exact Mass | 1028.53 |
| IUPAC Name | zinc 4-[(1Z,10Z,14Z)-10,15,20-tris(3,5-ditert-butylphenyl)-23H-porphyrin-22,24-diid-5-ylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)c1cc(/C2=C3\C=CC(=N3)C(=C3C=CC(=O)C=C3)c3ccc([n-]3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=c3/cc/c([nH]3)=C(\c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc2[n-]3)cc(C(C)(C)C)c1.[Zn+2] |
| InChI | InChI=1S/C68H77N4O.Zn/c1-63(2,3)44-31-41(32-45(37-44)64(4,5)6)60-53-25-23-51(69-53)59(40-19-21-50(73)22-20-40)52-24-26-54(70-52)61(42-33-46(65(7,8)9)38-47(34-42)66(10,11)12)56-28-30-58(72-56)62(57-29-27-55(60)71-57)43-35-48(67(13,14)15)39-49(36-43)68(16,17)18;/h19-39H,1-18H3,(H2-,69,70,71,72,73);/q-1;+2/p-1/b59-51-,59-52-,60-53-,60-55-,61-54-,61-56-,62-57-,62-58-; |
| InChIKey | XLOQRVLXCQAWPP-FBIDIKIQSA-M |
| XLogP | 14.44 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.77 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|