C17H20N6O — CID 136810313
(13S)-13-(2-ethyl-5-methyl-1H-imidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one (PubChem CID 136810313) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is (13S)-13-(2-ethyl-5-methyl-1H-imidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one.
| Compound Name | (13S)-13-(2-ethyl-5-methyl-1H-imidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
|---|---|
| PubChem CID | 136810313 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (13S)-13-(2-ethyl-5-methyl-1H-imidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
| SMILES | CCc1nc([C@H]2CC(=O)Nc3nn4c(C)cc(C)nc4c32)c(C)[nH]1 |
| InChI | InChI=1S/C17H20N6O/c1-5-12-19-10(4)15(20-12)11-7-13(24)21-16-14(11)17-18-8(2)6-9(3)23(17)22-16/h6,11H,5,7H2,1-4H3,(H,19,20)(H,21,22,24)/t11-/m0/s1 |
| InChIKey | SZYXIKZZDZNFSX-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |