C16H18N6O — CID 169416359
13-(1-ethylimidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one (PubChem CID 169416359) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 13-(1-ethylimidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one.
| Compound Name | 13-(1-ethylimidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
|---|---|
| PubChem CID | 169416359 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 13-(1-ethylimidazol-4-yl)-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
| SMILES | CCn1cnc(C2CC(=O)Nc3nn4c(C)cc(C)nc4c32)c1 |
| InChI | InChI=1S/C16H18N6O/c1-4-21-7-12(17-8-21)11-6-13(23)19-15-14(11)16-18-9(2)5-10(3)22(16)20-15/h5,7-8,11H,4,6H2,1-3H3,(H,19,20,23) |
| InChIKey | GBNUKZXQXGGIMX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |