C18H17N7O — CID 136882362
(13S)-4,6-dimethyl-13-(1-methylbenzotriazol-5-yl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one (PubChem CID 136882362) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is (13S)-4,6-dimethyl-13-(1-methylbenzotriazol-5-yl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one.
| Compound Name | (13S)-4,6-dimethyl-13-(1-methylbenzotriazol-5-yl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
|---|---|
| PubChem CID | 136882362 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (13S)-4,6-dimethyl-13-(1-methylbenzotriazol-5-yl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
| SMILES | Cc1cc(C)n2nc3c(c2n1)[C@H](c1ccc2c(c1)nnn2C)CC(=O)N3 |
| InChI | InChI=1S/C18H17N7O/c1-9-6-10(2)25-18(19-9)16-12(8-15(26)20-17(16)22-25)11-4-5-14-13(7-11)21-23-24(14)3/h4-7,12H,8H2,1-3H3,(H,20,22,26)/t12-/m0/s1 |
| InChIKey | WJGDKXXLXIHSQS-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |