C18H18N4O — CID 136697811
(13R)-13-benzyl-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one (PubChem CID 136697811) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is (13R)-13-benzyl-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one.
| Compound Name | (13R)-13-benzyl-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
|---|---|
| PubChem CID | 136697811 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (13R)-13-benzyl-4,6-dimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-one |
| SMILES | Cc1cc(C)n2nc3c(c2n1)[C@H](Cc1ccccc1)CC(=O)N3 |
| InChI | InChI=1S/C18H18N4O/c1-11-8-12(2)22-18(19-11)16-14(9-13-6-4-3-5-7-13)10-15(23)20-17(16)21-22/h3-8,14H,9-10H2,1-2H3,(H,20,21,23)/t14-/m1/s1 |
| InChIKey | ISDXDYVEHVNXAZ-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |