C18H21N3O7 — CID 136811989
(2S)-6-[acetyl(hydroxy)amino]-2-[[2-(2-hydroxyphenyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid (PubChem CID 136811989) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is (2S)-6-[acetyl(hydroxy)amino]-2-[[2-(2-hydroxyphenyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[acetyl(hydroxy)amino]-2-[[2-(2-hydroxyphenyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 136811989 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S)-6-[acetyl(hydroxy)amino]-2-[[2-(2-hydroxyphenyl)-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
| SMILES | CC(=O)N(O)CCCC[C@H](NC(=O)c1coc(-c2ccccc2O)n1)C(=O)O |
| InChI | InChI=1S/C18H21N3O7/c1-11(22)21(27)9-5-4-7-13(18(25)26)19-16(24)14-10-28-17(20-14)12-6-2-3-8-15(12)23/h2-3,6,8,10,13,23,27H,4-5,7,9H2,1H3,(H,19,24)(H,25,26)/t13-/m0/s1 |
| InChIKey | NYCZXPSZDDRKQM-ZDUSSCGKSA-N |
| XLogP | 1.64 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|