C29H28N2O4 — CID 159322008
2-(2-hydroxyphenyl)-N-(6-oxo-7,7-diphenylheptyl)-1,3-oxazole-4-carboxamide (PubChem CID 159322008) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-N-(6-oxo-7,7-diphenylheptyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-hydroxyphenyl)-N-(6-oxo-7,7-diphenylheptyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 159322008 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-(2-hydroxyphenyl)-N-(6-oxo-7,7-diphenylheptyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCCCC(=O)C(c1ccccc1)c1ccccc1)c1coc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C29H28N2O4/c32-25-17-10-9-16-23(25)29-31-24(20-35-29)28(34)30-19-11-3-8-18-26(33)27(21-12-4-1-5-13-21)22-14-6-2-7-15-22/h1-2,4-7,9-10,12-17,20,27,32H,3,8,11,18-19H2,(H,30,34) |
| InChIKey | LDWQOQZPMGOTHH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|