C19H27N3O2 — CID 3295381
2-(2-aminophenyl)-N-nonyl-1,3-oxazole-4-carboxamide (PubChem CID 3295381) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-nonyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-nonyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3295381 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-(2-aminophenyl)-N-nonyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCCCNC(=O)c1coc(-c2ccccc2N)n1 |
| InChI | InChI=1S/C19H27N3O2/c1-2-3-4-5-6-7-10-13-21-18(23)17-14-24-19(22-17)15-11-8-9-12-16(15)20/h8-9,11-12,14H,2-7,10,13,20H2,1H3,(H,21,23) |
| InChIKey | BYUZVWFSTPUEOR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|