C17H23N3O2 — CID 3721367
2-(2-aminophenyl)-N-heptyl-1,3-oxazole-4-carboxamide (PubChem CID 3721367) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-heptyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-heptyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3721367 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-(2-aminophenyl)-N-heptyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCNC(=O)c1coc(-c2ccccc2N)n1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-3-4-5-8-11-19-16(21)15-12-22-17(20-15)13-9-6-7-10-14(13)18/h6-7,9-10,12H,2-5,8,11,18H2,1H3,(H,19,21) |
| InChIKey | FWTMXSCLNXGIKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|