C19H23N5O2 — CID 3286604
2-(5-amino-1-phenylpyrazol-4-yl)-N-hexyl-1,3-oxazole-4-carboxamide (PubChem CID 3286604) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-(5-amino-1-phenylpyrazol-4-yl)-N-hexyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(5-amino-1-phenylpyrazol-4-yl)-N-hexyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3286604 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-(5-amino-1-phenylpyrazol-4-yl)-N-hexyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1coc(-c2cnn(-c3ccccc3)c2N)n1 |
| InChI | InChI=1S/C19H23N5O2/c1-2-3-4-8-11-21-18(25)16-13-26-19(23-16)15-12-22-24(17(15)20)14-9-6-5-7-10-14/h5-7,9-10,12-13H,2-4,8,11,20H2,1H3,(H,21,25) |
| InChIKey | LZSHAZDSKXXIDH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|