C19H22FN3O3 — CID 90965796
N-[6-(3-fluoroazetidin-1-yl)-6-oxohexyl]-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 90965796) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[6-(3-fluoroazetidin-1-yl)-6-oxohexyl]-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[6-(3-fluoroazetidin-1-yl)-6-oxohexyl]-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90965796 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[6-(3-fluoroazetidin-1-yl)-6-oxohexyl]-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCCCCC(=O)N1CC(F)C1)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H22FN3O3/c20-15-11-23(12-15)17(24)9-5-2-6-10-21-18(25)16-13-26-19(22-16)14-7-3-1-4-8-14/h1,3-4,7-8,13,15H,2,5-6,9-12H2,(H,21,25) |
| InChIKey | RGDSODDDNBDSHN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|