C45H30N4 — CID 136819212
6-methyl-13,18,23-triphenyl-11,27,28,29-tetrazaheptacyclo[22.2.1.19,12.114,17.119,22.02,10.03,8]triaconta-1,3(8),4,6,9(30),10,12,14,16,18,20,22(28),23,25-tetradecaene (PubChem CID 136819212) has the molecular formula C45H30N4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 6-methyl-13,18,23-triphenyl-11,27,28,29-tetrazaheptacyclo[22.2.1.19,12.114,17.119,22.02,10.03,8]triaconta-1,3(8),4,6,9(30),10,12,14,16,18,20,22(28),23,25-tetradecaene.
| Compound Name | 6-methyl-13,18,23-triphenyl-11,27,28,29-tetrazaheptacyclo[22.2.1.19,12.114,17.119,22.02,10.03,8]triaconta-1,3(8),4,6,9(30),10,12,14,16,18,20,22(28),23,25-tetradecaene |
|---|---|
| PubChem CID | 136819212 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 6-methyl-13,18,23-triphenyl-11,27,28,29-tetrazaheptacyclo[22.2.1.19,12.114,17.119,22.02,10.03,8]triaconta-1,3(8),4,6,9(30),10,12,14,16,18,20,22(28),23,25-tetradecaene |
| SMILES | Cc1ccc2c(c1)C1=Cc3nc1c-2c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c2ccccc2)c2ccc([nH]2)c3-c2ccccc2)C=C1 |
| InChI | InChI=1S/C45H30N4/c1-27-17-18-31-32(25-27)33-26-40-43(30-15-9-4-10-16-30)38-22-21-36(47-38)41(28-11-5-2-6-12-28)34-19-20-35(46-34)42(29-13-7-3-8-14-29)37-23-24-39(48-37)44(31)45(33)49-40/h2-26,47-48H,1H3/b41-34-,41-36-,42-35-,42-37-,43-38-,43-40-,44-39- |
| InChIKey | XMENYFPNOFGWBM-PEENIAGPSA-N |
| XLogP | 11.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |