C68H46N4Pt — CID 87789482
5,8,10,12,13,15,20,23-octakis-phenyl-21H-porphyrin;platinum (PubChem CID 87789482) has the molecular formula C68H46N4Pt and a molecular weight of 1114.22 g/mol. Its IUPAC name is 5,8,10,12,13,15,20,23-octakis-phenyl-21H-porphyrin;platinum.
| Compound Name | 5,8,10,12,13,15,20,23-octakis-phenyl-21H-porphyrin;platinum |
|---|---|
| PubChem CID | 87789482 |
| Molecular Formula | C68H46N4Pt |
| Molecular Weight | 1114.22 g/mol |
| Exact Mass | 1113.34 |
| IUPAC Name | 5,8,10,12,13,15,20,23-octakis-phenyl-21H-porphyrin;platinum |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3c(-c4ccccc4)c(-c4ccccc4)c(c2-c2ccccc2)n3-c2ccccc2)C(c2ccccc2)=C1.[Pt] |
| InChI | InChI=1S/C68H46N4.Pt/c1-9-25-46(26-10-1)54-45-59-61(48-29-13-3-14-30-48)57-42-41-55(69-57)60(47-27-11-2-12-28-47)56-43-44-58(70-56)62(49-31-15-4-16-32-49)67-63(50-33-17-5-18-34-50)64(51-35-19-6-20-36-51)68(72(67)53-39-23-8-24-40-53)65(66(54)71-59)52-37-21-7-22-38-52;/h1-45,69H;/b60-55-,60-56-,61-57-,61-59-,62-58-,66-65-,67-62-,68-65-; |
| InChIKey | HWBAQMSDIUOQPO-MXRRZWSASA-N |
| XLogP | 17.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.22 |
| LogP ≤ 5 | 17.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |