C73H54N4O3 — CID 175979549
5-[2-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)phenoxy]pentanoic acid (PubChem CID 175979549) has the molecular formula C73H54N4O3 and a molecular weight of 1035.26 g/mol. Its IUPAC name is 5-[2-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)phenoxy]pentanoic acid.
| Compound Name | 5-[2-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 175979549 |
| Molecular Formula | C73H54N4O3 |
| Molecular Weight | 1035.26 g/mol |
| Exact Mass | 1034.42 |
| IUPAC Name | 5-[2-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)phenoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1ccccc1-c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4c(-c5ccccc5)c(-c5ccccc5)c1n4-c1ccccc1)C=C3)C=C2c1ccccc1 |
| InChI | InChI=1S/C73H54N4O3/c78-64(79)42-24-25-47-80-63-41-23-22-40-56(63)70-71-57(49-26-8-1-9-27-49)48-62(76-71)66(51-30-12-3-13-31-51)60-44-43-58(74-60)65(50-28-10-2-11-29-50)59-45-46-61(75-59)67(52-32-14-4-15-33-52)72-68(53-34-16-5-17-35-53)69(54-36-18-6-19-37-54)73(70)77(72)55-38-20-7-21-39-55/h1-23,26-41,43-46,48,74H,24-25,42,47H2,(H,78,79)/b65-58-,65-59-,66-60-,66-62-,67-61-,71-70-,72-67-,73-70- |
| InChIKey | IJHVPCBVVGFPDU-KTUJMZLLSA-N |
| XLogP | 18.17 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.26 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|