C69H46N4O2 — CID 175979554
4-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)benzoic acid (PubChem CID 175979554) has the molecular formula C69H46N4O2 and a molecular weight of 963.15 g/mol. Its IUPAC name is 4-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)benzoic acid.
| Compound Name | 4-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 175979554 |
| Molecular Formula | C69H46N4O2 |
| Molecular Weight | 963.15 g/mol |
| Exact Mass | 962.36 |
| IUPAC Name | 4-(2,3,7,10,15,20,21-heptakis-phenyl-23H-porphyrin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5c(-c6ccccc6)c(-c6ccccc6)c2n5-c2ccccc2)C=C4)C=C3c2ccccc2)cc1 |
| InChI | InChI=1S/C69H46N4O2/c74-69(75)52-38-36-51(37-39-52)65-66-54(45-22-8-1-9-23-45)44-59(72-66)61(47-26-12-3-13-27-47)57-41-40-55(70-57)60(46-24-10-2-11-25-46)56-42-43-58(71-56)62(48-28-14-4-15-29-48)67-63(49-30-16-5-17-31-49)64(50-32-18-6-19-33-50)68(65)73(67)53-34-20-7-21-35-53/h1-44,70H,(H,74,75)/b60-55-,60-56-,61-57-,61-59-,62-58-,66-65-,67-62-,68-65- |
| InChIKey | SBMGYARBUDHFCV-YZIHDKPWSA-N |
| XLogP | 17.24 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.15 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |