C13H21ClN4O2 — CID 136821595
ethyl N-[2-amino-6-(cyclopentylamino)pyridin-1-ium-3-yl]carbamate chloride (PubChem CID 136821595) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is ethyl N-[2-amino-6-(cyclopentylamino)pyridin-1-ium-3-yl]carbamate chloride.
| Compound Name | ethyl N-[2-amino-6-(cyclopentylamino)pyridin-1-ium-3-yl]carbamate chloride |
|---|---|
| PubChem CID | 136821595 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl N-[2-amino-6-(cyclopentylamino)pyridin-1-ium-3-yl]carbamate chloride |
| SMILES | CCOC(=O)Nc1ccc(NC2CCCC2)[nH+]c1N.[Cl-] |
| InChI | InChI=1S/C13H20N4O2.ClH/c1-2-19-13(18)16-10-7-8-11(17-12(10)14)15-9-5-3-4-6-9;/h7-9H,2-6H2,1H3,(H,16,18)(H3,14,15,17);1H |
| InChIKey | YSKBKMBERCSJIV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |