C20H24N4O7 — CID 136821465
ethyl N-[2-amino-6-[(2-methoxyphenyl)methylamino]pyridin-1-ium-3-yl]carbamate;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 136821465) has the molecular formula C20H24N4O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[(2-methoxyphenyl)methylamino]pyridin-1-ium-3-yl]carbamate;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | ethyl N-[2-amino-6-[(2-methoxyphenyl)methylamino]pyridin-1-ium-3-yl]carbamate;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 136821465 |
| Molecular Formula | C20H24N4O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | ethyl N-[2-amino-6-[(2-methoxyphenyl)methylamino]pyridin-1-ium-3-yl]carbamate;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccccc2OC)[nH+]c1N.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C16H20N4O3.C4H4O4/c1-3-23-16(21)19-12-8-9-14(20-15(12)17)18-10-11-6-4-5-7-13(11)22-2;5-3(6)1-2-4(7)8/h4-9H,3,10H2,1-2H3,(H,19,21)(H3,17,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QTQNQCPASYNQFO-WLHGVMLRSA-N |
| XLogP | 0.65 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|