C10H12N6O2 — CID 136834159
[(2S,4S)-4-(7-imino-2H-triazolo[4,5-d]pyrimidin-4-yl)-3-methylideneoxolan-2-yl]methanol (PubChem CID 136834159) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is [(2S,4S)-4-(7-imino-2H-triazolo[4,5-d]pyrimidin-4-yl)-3-methylideneoxolan-2-yl]methanol.
| Compound Name | [(2S,4S)-4-(7-imino-2H-triazolo[4,5-d]pyrimidin-4-yl)-3-methylideneoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 136834159 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [(2S,4S)-4-(7-imino-2H-triazolo[4,5-d]pyrimidin-4-yl)-3-methylideneoxolan-2-yl]methanol |
| SMILES | [H]/N=c1\ncn([C@@H]2CO[C@H](CO)C2=C)c2n[nH]nc12 |
| InChI | InChI=1S/C10H12N6O2/c1-5-6(3-18-7(5)2-17)16-4-12-9(11)8-10(16)14-15-13-8/h4,6-7,11,17H,1-3H2,(H,13,14,15)/b11-9-/t6-,7-/m1/s1 |
| InChIKey | BWOPFRRGZZSWCY-KARNKZGOSA-N |
| XLogP | -0.88 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|