C10H11N5O3 — CID 135713086
(10R,11S,12R,13S)-5-imino-15-oxa-2,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-1(14),3,6-triene-11,12-diol (PubChem CID 135713086) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is (10R,11S,12R,13S)-5-imino-15-oxa-2,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-1(14),3,6-triene-11,12-diol.
| Compound Name | (10R,11S,12R,13S)-5-imino-15-oxa-2,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-1(14),3,6-triene-11,12-diol |
|---|---|
| PubChem CID | 135713086 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (10R,11S,12R,13S)-5-imino-15-oxa-2,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-1(14),3,6-triene-11,12-diol |
| SMILES | [H]/N=c1\ncn2c3c([nH]nc13)[C@@H]1O[C@H](C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H11N5O3/c11-10-5-6-4(13-14-5)9-8(17)7(16)3(18-9)1-15(6)2-12-10/h2-3,7-9,11,16-17H,1H2,(H,13,14)/b11-10-/t3-,7-,8-,9+/m1/s1 |
| InChIKey | GVRZAYXRDIDVBX-XOFPLSEYSA-N |
| XLogP | -1.59 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |