C10H10N4O5 — CID 15939533
(10R,11R,12S,13R)-11,12-dihydroxy-15-oxa-1,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-2,4(14)-diene-5,7-dione (PubChem CID 15939533) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is (10R,11R,12S,13R)-11,12-dihydroxy-15-oxa-1,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-2,4(14)-diene-5,7-dione.
| Compound Name | (10R,11R,12S,13R)-11,12-dihydroxy-15-oxa-1,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-2,4(14)-diene-5,7-dione |
|---|---|
| PubChem CID | 15939533 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (10R,11R,12S,13R)-11,12-dihydroxy-15-oxa-1,3,6,8-tetrazatetracyclo[6.5.1.110,13.04,14]pentadeca-2,4(14)-diene-5,7-dione |
| SMILES | O=c1[nH]c(=O)n2c3c1ncn3[C@@H]1O[C@H](C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H10N4O5/c15-5-3-1-13-8-4(7(17)12-10(13)18)11-2-14(8)9(19-3)6(5)16/h2-3,5-6,9,15-16H,1H2,(H,12,17,18)/t3-,5+,6+,9-/m1/s1 |
| InChIKey | ZZCRHLWLBFCBOJ-GFRUICAKSA-N |
| XLogP | -2.48 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |