C13H14N4O7 — CID 57000497
3-[9-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopurin-3-yl]prop-2-enal (PubChem CID 57000497) has the molecular formula C13H14N4O7 and a molecular weight of 338.28 g/mol. Its IUPAC name is 3-[9-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopurin-3-yl]prop-2-enal.
| Compound Name | 3-[9-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopurin-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 57000497 |
| Molecular Formula | C13H14N4O7 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[9-[(2S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopurin-3-yl]prop-2-enal |
| SMILES | O=CC=Cn1c(=O)[nH]c(=O)c2ncn([C@H]3O[C@@H](CO)C(O)C3O)c21 |
| InChI | InChI=1S/C13H14N4O7/c18-3-1-2-16-11-7(10(22)15-13(16)23)14-5-17(11)12-9(21)8(20)6(4-19)24-12/h1-3,5-6,8-9,12,19-21H,4H2,(H,15,22,23)/t6-,8?,9?,12-/m0/s1 |
| InChIKey | ZSIFUCYSDCHESH-BLWDTKHVSA-N |
| XLogP | -2.83 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|