C10H12N4O5 — CID 11737240
(10R,12R)-10,12-bis(hydroxymethyl)-11-oxa-1,3,6,8-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-5,7-dione (PubChem CID 11737240) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is (10R,12R)-10,12-bis(hydroxymethyl)-11-oxa-1,3,6,8-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-5,7-dione.
| Compound Name | (10R,12R)-10,12-bis(hydroxymethyl)-11-oxa-1,3,6,8-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-5,7-dione |
|---|---|
| PubChem CID | 11737240 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (10R,12R)-10,12-bis(hydroxymethyl)-11-oxa-1,3,6,8-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13)-diene-5,7-dione |
| SMILES | O=c1[nH]c(=O)n2c3c1ncn3[C@@H](CO)O[C@@H](CO)C2 |
| InChI | InChI=1S/C10H12N4O5/c15-2-5-1-13-9-7(8(17)12-10(13)18)11-4-14(9)6(3-16)19-5/h4-6,15-16H,1-3H2,(H,12,17,18)/t5-,6-/m1/s1 |
| InChIKey | RKUSVXXEKOQBAU-PHDIDXHHSA-N |
| XLogP | -2.23 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |